
chemická sloučenina

Sinapylalkohol je organická sloučenina strukturou podobná kyselině skořicové. Je syntetizován v metabolismu fenylpropanoidů, jeho přímým prekurzorem je sinapaldehyd. Tato látka patří mezi monolignoly, což je skupina látek, které jsou prekurzory ligninu a lignanů.[1] Rovněž se jedná o biosyntetický prekurzor stilbenoidů a kumarinů.

Strukturní vzorec

Strukturní vzorec

Systematický název 4-(3-hydroxyprop-1-en-1-yl)-2,6-dimethoxyfenol
Anglický název Sinapyl alcohol
Německý název Sinapylalkohol
Sumární vzorec C11H14O4
Vzhled bezbarvá kapalina
Registrační číslo CAS
SMILES OC/C=C/c1cc(OC)c(O)c(OC)c1
Molární hmotnost 210,226 g/mol
Teplota tání 61-65 °C (334-338 K)
Není-li uvedeno jinak, jsou použity
jednotky SI a STP (25 °C, 100 kPa).
Některá data mohou pocházet z datové položky.


Související článkyEditovat


V tomto článku byl použit překlad textu z článku Sinapyl alcohol na anglické Wikipedii.

  1. BOERJAN, Wout; RALPH, John; BAUCHER, Marie. Lignin Biosynthesis. Annu. Rev. Plant Biol.. 2003, s. 519–546. DOI:10.1146/annurev.arplant.54.031902.134938. (anglicky)