Kyselina pektinová

chemická sloučenina

Kyselina pektinová (také kyselina polygalakturonová) je ve vodě rozpustná, průhledná gelovitá kyselina, která se vyskytuje ve zralém ovoci a v některých druzích zeleniny. Je produktem degradace pektinu v rostlinách, z něhož vzniká působením enzymu pektinázy.

Kyselina pektinová
Strukturní vzorec

Strukturní vzorec

Obecné
Systematický název kyselina poly(1,4-α-D-galakturonová)
Ostatní názvy kyselina polygalakturonová
Anglický název Pectic acid
Sumární vzorec (C6H8O6)n
Vzhled průhledná gelovitá pená látka
Identifikace
Registrační číslo CAS
PubChem
SMILES O=C(O)[C@H]3OC(O[C@@H]1[C@H](O)[C@@H](O)C(O[C@@H]1C(=O)O)O[C@H]2[C@H](O[C@H](O)[C@H](O)[C@H]2O)C(=O)O)[C@H](O)[C@@H](O)[C@H]3O
InChI 1S/C18H26O19/c19-1-2(20)10(13(26)27)36-17(6(1)24)35-9-4(22)7(25)18(37-12(9)15(30)31)34-8-3(21)5(23)16(32)33-11(8)14(28)29/h1-12,16-25,32H,(H,26,27)(H,28,29)(H,30,31)/t1-,2+,3+,4+,5+,6+,7+,8+,9+,10-,11-,12-,16-,17?,18?/m0/s1
Vlastnosti
Molární hmotnost různá
Není-li uvedeno jinak, jsou použity
jednotky SI a STP (25 °C, 100 kPa).
Některá data mohou pocházet z datové položky.

ReferenceEditovat

V tomto článku byl použit překlad textu z článku Pectic acid na anglické Wikipedii.