Otevřít hlavní menu

Kyselina muramová (systematický název kyselina 2-[3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanová) je cukerná aminokyselina, ether kyseliny mléčné a glukózaminu. V přírodě se vyskytuje její derivát kyselina N-acetylmuramová, jež je součástí peptidoglykanů, které jsou součástmi buněčných stěn mnoha bakterií.[1]

Kyselina muramová
Strukturní vzorec

Strukturní vzorec

Obecné
Systematický název kyselina 2-[3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanová
Triviální název kyselina muramová
Ostatní názvy kyselina 3-deoxy-D-manno-okt-2-ulózonová
Anglický název Muramic acid
2-[3-amino-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid
Sumární vzorec C9H17NO7
Identifikace
PubChem
SMILES CC(OC1C(N)C(O)OC(CO)C1O)C(O)=O
InChI 1/C9H17NO7/c1-3(8(13)14)16-7-5(10)9(15)17-4(2-11)6(7)12/h3-7,9,11-12,15H,2,10H2,1H3,(H,13,14)/t3?,4-,5-,6-,7?,9?/m1/s1
Vlastnosti
Molární hmotnost 251,234 g/mol
Není-li uvedeno jinak, jsou použity
jednotky SI a STP (25 °C, 100 kPa).
Některá data mohou pocházet z datové položky.

ReferenceEditovat

V tomto článku byl použit překlad textu z článku Muramic acid na anglické Wikipedii.

  1. Muramic acid - Compound Summary, PubChem.