Otevřít hlavní menu

Změny

Velikost nezměněna, před 1 rokem
m
Robot: přidáno {{Autoritní data}}; kosmetické úpravy
{{Infobox - chemická sloučenina
| název = Testosteron
| obrázek = Testosteron.svg
| velikost obrázku = 140px
| popisek = Strukturní vzorec testosteronu
| systematický název =
| triviální název = Testosteron
| anglický název = Testosterone
| německý název = Testosterone
| sumární vzorec = C<sub>19</sub>H<sub>28</sub>O<sub>2</sub>
| vzhled = bezbarvá pevná látka
| číslo CAS = 58-22-0
 
| PubChem = 6013
|číslo CAS= 58-22-0
| SMILES = O=C4\C=C2/[C@]([C@H]1CC[C@@]3([C@@H](O)CC[C@H]3[C@@H]1CC2)C)(C)CC4
|PubChem=6013
| InChI = 1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1
|SMILES= O=C4\C=C2/[C@]([C@H]1CC[C@@]3([C@@H](O)CC[C@H]3[C@@H]1CC2)C)(C)CC4
| molární hmotnost = 288,42&nbsp;g/mol
|InChI= 1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1
| teplota tání = 155&nbsp;°C
 
| hustota =
|molární hmotnost= 288,42&nbsp;g/mol
| rozpustnost = Prakticky nerozpustný
|teplota tání=155&nbsp;°C
| rozpustnost polární =
|hustota=
|rozpustnost= Prakticky nerozpustný
|rozpustnost polární=
}}
[[Soubor:Depo-testosterone 200 mg ml.jpg|thumbnáhled|léková forma]]
 
'''Testosteron''' je [[steroidy|steroidní]] [[hormon]] ze skupiny androgenů. Řadí se mezi [[anabolické steroidy]], je to mužský [[pohlavní hormon]] ([[androgen]]).
== Produkce a působení ==
Přirozenou cestou vzniká testosteron v&nbsp;[[Leydigova buňka|Leydigových buňkách]] ve varlatech.<ref>{{citace monografie| příjmení= Junqueira| jméno=Luiz Carlos | jméno2=Jose |příjmení2=Carneiro|rok= 2005| titul=Basic Histology text and atlas| vydání=11| vydavatel=McGraw Hill}}</ref> Ovlivňuje [[spermatogeneze|spermatogenezi]] a vývoj [[sekundární pohlavní znaky|sekundárních pohlavních znaků]]. Patrný je jeho vliv především v&nbsp;[[puberta|pubertě]], kdy dochází k&nbsp;růstu [[varle|varlat]] a [[penis]]u, pigmentaci a vrásnění [[šourek|šourku]], po [[tělo|těle]] začíná růst [[chlup|ochlupení]], zvětšuje se [[předstojná žláza|prostata]] a [[hrtan]], dochází k&nbsp;nárůstu [[sval]]ové hmoty. V&nbsp;dospělosti testosteron s&nbsp;jinými [[androgen]]y udržuje mužský charakter ochlupení, stimuluje [[spermatogeneze|spermatogenezi]] a brání rozvoji [[osteoporóza|osteoporózy]]. Ze společenského hlediska je spojován s&nbsp;dominancí, libidem a agresivitou; je zkoumán jeho vliv na čestné chování.<ref>[http://www.rozhlas.cz/leonardo/zpravy/_zprava/testosteron-podporuje-cestne-chovani--1121822 Testosteron podporuje čestné chování]</ref> Znamením vyšší hladiny testosteronu je také lepší prostorová představivost.<ref>[http://www.rozhlas.cz/leonardo/zpravy/_zprava/proc-maji-muzi-lepsi-prostorovou-predstavivost--1177947 Proč mají muži lepší prostorovou představivost]</ref> Úroveň testosteronu u mužů historicky klesá.<ref>https://www.endocrine.org/news-room/press-release-archives/2006/testosterone_lvls_in_men_decline - Testosterone Levels in Men Decline Over Past Two Decades, Study Shows</ref>
Produkci u muže zajišťují ze 2/3 [[Varle|varlata]] a z 1/3 [[nadledviny]]. U ženy jsou naopak nadledviny hlavním zdrojem mužských hormonů, testosteron u nich však zároveň vzniká i v ovariu.
 
=== Léky ===
 
{{Portály|Chemie}}
{{Autoritní data}}
 
[[Kategorie:ATC G03BA]]
1 084 181

editací