Benzoát sodný: Porovnání verzí

Přidáno 50 bajtů ,  před 4 lety
m
(→‎Výskyt v přírodě: předělání odkazu)
m (odebrání parametrů pro nadpisy viz Wikipedie:Bot/Žádosti o provedení práce/archiv-14#Automatické zobrazování nadpisů; kosmetické úpravy)
{{Infobox - chemická sloučenina
| název = Benzoát sodný
| obrázek = Sodium Benzoate V.1.svg
| velikost obrázku = 150px
| popisek = Strukturní vzorec
| systematický název = Benzenkarboxylát sodný
| triviální název = Benzoát sodný
| ostatní názvy = Sodná sůl kyseliny benzoové<br /> Sodná sůl kyseliny dracylikové<br /> Sodná sůl kyseliny fenylkarboxylové
| anglický název = Sodium benzoate
| německý název = Natriumbenzoat
| funkční vzorec = C<sub>6</sub>H<sub>5</sub>COONa
| sumární vzorec = C<sub>7</sub>H<sub>5</sub>NaO<sub>2</sub>
| vzhled = Bílá práškovitá látka
 
| číslo CAS = 532-32-1
| SMILES = O=C([O-])C1=CC=CC=C1.[Na+]
 
| molární hmotnost = 144,11&nbsp;g/mol
| teplota tání = 410–430&nbsp;°C
| teplota varu = rozklad
| hustota = 1,44&nbsp;g/cm<sup>3</sup>
| pKa = 9,8
| rozpustnost = 66&nbsp;g/100&nbsp;ml (''20&nbsp;°C'')
 
|S R-věty = ''Žádné nebezpečí''
|bezpečnost=zobrazit
|R S-věty = ''Žádné nebezpečí''
| číslo RTECS = DH6650000
|S-věty= ''Žádné nebezpečí''
|číslo RTECS= DH6650000
}}
 
'''Benzoát sodný''' je [[sodík|sodná]] [[soli|sůl]] [[kyselina benzoová|kyseliny benzoové]] (kyseliny benzenkarboxylové). V potravinářství je známa pod svým [[přídatné látky|E kódem]] E&nbsp;211. Dále má také své uplatnění v pyrotechnice.
 
== Výskyt ==
341 762

editací