Rifampicin

chemická sloučenina

Rifampicin nebo také rifampin (dle americké nomenklatury) je baktericidní antibiotikum ze skupiny rifamycinů. Jedná se semisyntetický produkt izolovaný z plísně Amycolatopsis rifamycinica. Rifampicin je dominantním lékem při léčbě tuberkulózy a lepry. Je účinný rovněž proti infekcím způsobených bakteriemi rodů Listeria, Legionella, Haemophillus, Neisseria. Mechanismus účinku spočívá v inhibici RNA-polymerázy v bakterialních buňkách, tím je znemožněna transkripce do mRNA a nedochází k syntéze proteinů.

rifampicin
Schéma chemické struktury
Název (INN) rifampicin (angličtina)
Kódy
Číslo CAS 13292-46-1
ChEMBL ID CHEMBL374478
ChemSpider ID 10468813
PubChem 5381226
Chemie
Sumární vzorec C₄₃H₅₈N₄O₁₂
SMILES O=C(OC1C(C)C(O)C(C)C(O)C(C=CC=C(C(O)=NC=2C(O)=C3C(O)=C(C=4OC(OC=CC(OC)C1C)(C(=O)C4C3=C(O)C2C=NN5CCN(C)CC5)C)C)C)C)C
InChI InChI=1S/C43H58N4O12/c1-21-12-11-13-22(2)42(55)45-33-28(20-44-47-17-15-46(9)16-18-47)37(52)30-31(38(33)53)36(51)26(6)40-32(30)41(54)43(8,59-40)57-19-14-29(56-10)23(3)39(58-27(7)48)25(5)35(50)24(4)34(21)49/h11-14,19-21,23-25,29,34-35,39,49-53H,15-18H2,1-10H3,(H,45,55)/b12-11+,19-14+,22-13-,44-20+/t21-,23+,24+,25+,29-,34-,35+,39+,43-/m0/s1
Molární hmotnost 822,94 u
Farmakologie
Indikace tuberkulózní meningitida, lymph node tuberculosis, pulmonary tuberculosis, miliární tuberkulóza a staphylococcal infection
Cesty podání ústní podání a infuze
Některá data mohou pocházet z datové položky.

Externí odkazyEditovat